C29H29N3 — CID 7085505
4-[2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 7085505) has the molecular formula C29H29N3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-[2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7085505 |
| Molecular Formula | C29H29N3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 4-[2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=Cc2cc(/C=C/c3ccc(N(C)C)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C29H29N3/c1-31(2)26-17-11-22(12-18-26)9-15-24-21-25(30-29-8-6-5-7-28(24)29)16-10-23-13-19-27(20-14-23)32(3)4/h5-21H,1-4H3/b15-9?,16-10+ |
| InChIKey | JYZURQWLRUTRQE-HHEGBNDJSA-N |
| XLogP | 6.71 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|