C19H19ClN2 — CID 6508810
N,N-dimethyl-4-[(E)-2-quinolin-2-ylethenyl]aniline;hydrochloride (PubChem CID 6508810) has the molecular formula C19H19ClN2 and a molecular weight of 310.83 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-quinolin-2-ylethenyl]aniline;hydrochloride.
| Compound Name | N,N-dimethyl-4-[(E)-2-quinolin-2-ylethenyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 6508810 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-quinolin-2-ylethenyl]aniline;hydrochloride |
| SMILES | CN(C)c1ccc(/C=C/c2ccc3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C19H18N2.ClH/c1-21(2)18-13-8-15(9-14-18)7-11-17-12-10-16-5-3-4-6-19(16)20-17;/h3-14H,1-2H3;1H/b11-7+; |
| InChIKey | RBYAUDVGAZHYSJ-RVDQCCQOSA-N |
| XLogP | 4.89 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|