C20H17F3N2 — CID 71653668
N,N-dimethyl-4-[(E)-2-[6-(trifluoromethyl)quinolin-2-yl]ethenyl]aniline (PubChem CID 71653668) has the molecular formula C20H17F3N2 and a molecular weight of 342.36 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[6-(trifluoromethyl)quinolin-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[6-(trifluoromethyl)quinolin-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 71653668 |
| Molecular Formula | C20H17F3N2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[6-(trifluoromethyl)quinolin-2-yl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccc3cc(C(F)(F)F)ccc3n2)cc1 |
| InChI | InChI=1S/C20H17F3N2/c1-25(2)18-10-4-14(5-11-18)3-8-17-9-6-15-13-16(20(21,22)23)7-12-19(15)24-17/h3-13H,1-2H3/b8-3+ |
| InChIKey | LQRAECYTKKCHNT-FPYGCLRLSA-N |
| XLogP | 5.49 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|