C24H26N4 — CID 50936651
4-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyrazin-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 50936651) has the molecular formula C24H26N4 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyrazin-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyrazin-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 50936651 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyrazin-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2cnc(/C=C/c3ccc(N(C)C)cc3)cn2)cc1 |
| InChI | InChI=1S/C24H26N4/c1-27(2)23-13-7-19(8-14-23)5-11-21-17-26-22(18-25-21)12-6-20-9-15-24(16-10-20)28(3)4/h5-18H,1-4H3/b11-5+,12-6+ |
| InChIKey | OMKMYQUNLPDCNP-YDWXAUTNSA-N |
| XLogP | 4.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|