C9H14N2O — CID 30029908
4-methoxy-1-N,1-N-dimethylbenzene-1,3-diamine (PubChem CID 30029908) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-methoxy-1-N,1-N-dimethylbenzene-1,3-diamine.
| Compound Name | 4-methoxy-1-N,1-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 30029908 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 4-methoxy-1-N,1-N-dimethylbenzene-1,3-diamine |
| SMILES | COc1ccc(N(C)C)cc1N |
| InChI | InChI=1S/C9H14N2O/c1-11(2)7-4-5-9(12-3)8(10)6-7/h4-6H,10H2,1-3H3 |
| InChIKey | KSJMQUBTZAZILT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|