About ethane;quinoxalin-6-amine
ethane;quinoxalin-6-amine (PubChem CID 143926479) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is ethane;quinoxalin-6-amine.
Molecular Properties
| Compound Name | ethane;quinoxalin-6-amine |
| PubChem CID | 143926479 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | ethane;quinoxalin-6-amine |
| SMILES | CC.Nc1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H7N3.C2H6/c9-6-1-2-7-8(5-6)11-4-3-10-7;1-2/h1-5H,9H2;1-2H3 |
| InChIKey | JZKMXECVFWXNDO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;quinoxalin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;quinoxalin-6-amine?
The IUPAC name of ethane;quinoxalin-6-amine (CID 143926479) is ethane;quinoxalin-6-amine.
What is the SMILES notation for ethane;quinoxalin-6-amine?
The canonical SMILES for ethane;quinoxalin-6-amine is CC.Nc1ccc2nccnc2c1.
What is the InChIKey of ethane;quinoxalin-6-amine?
The InChIKey is JZKMXECVFWXNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.C2H6/c9-6-1-2-7-8(5-6)11-4-3-10-7;1-2/h1-5H,9H2;1-2H3.
What are the key properties of ethane;quinoxalin-6-amine?
ethane;quinoxalin-6-amine has a molecular weight of 175.23 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;quinoxalin-6-amine is sourced from PubChem (CID 143926479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).