About benzo[b][1,7]phenanthrolin-10-amine
benzo[b][1,7]phenanthrolin-10-amine (PubChem CID 10332108) has the molecular formula C16H11N3
and a molecular weight of 245.29 g/mol. Its IUPAC name is benzo[b][1,7]phenanthrolin-10-amine.
Molecular Properties
| Compound Name | benzo[b][1,7]phenanthrolin-10-amine |
| PubChem CID | 10332108 |
| Molecular Formula | C16H11N3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | benzo[b][1,7]phenanthrolin-10-amine |
| SMILES | Nc1ccc2cc3ccc4ncccc4c3nc2c1 |
| InChI | InChI=1S/C16H11N3/c17-12-5-3-10-8-11-4-6-14-13(2-1-7-18-14)16(11)19-15(10)9-12/h1-9H,17H2 |
| InChIKey | FLQAOBBPUNPVJK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[b][1,7]phenanthrolin-10-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[b][1,7]phenanthrolin-10-amine?
The IUPAC name of benzo[b][1,7]phenanthrolin-10-amine (CID 10332108) is benzo[b][1,7]phenanthrolin-10-amine.
What is the SMILES notation for benzo[b][1,7]phenanthrolin-10-amine?
The canonical SMILES for benzo[b][1,7]phenanthrolin-10-amine is Nc1ccc2cc3ccc4ncccc4c3nc2c1.
What is the InChIKey of benzo[b][1,7]phenanthrolin-10-amine?
The InChIKey is FLQAOBBPUNPVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3/c17-12-5-3-10-8-11-4-6-14-13(2-1-7-18-14)16(11)19-15(10)9-12/h1-9H,17H2.
What are the key properties of benzo[b][1,7]phenanthrolin-10-amine?
benzo[b][1,7]phenanthrolin-10-amine has a molecular weight of 245.29 g/mol, XLogP of 3.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[b][1,7]phenanthrolin-10-amine is sourced from PubChem (CID 10332108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).