C32H25N7 — CID 175508465
1,7-phenanthrolin-2-amine;bis(2-pyridin-2-ylpyridine) (PubChem CID 175508465) has the molecular formula C32H25N7 and a molecular weight of 507.60 g/mol. Its IUPAC name is 1,7-phenanthrolin-2-amine;bis(2-pyridin-2-ylpyridine).
| Compound Name | 1,7-phenanthrolin-2-amine;bis(2-pyridin-2-ylpyridine) |
|---|---|
| PubChem CID | 175508465 |
| Molecular Formula | C32H25N7 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 1,7-phenanthrolin-2-amine;bis(2-pyridin-2-ylpyridine) |
| SMILES | Nc1ccc2ccc3ncccc3c2n1.c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C12H9N3.2C10H8N2/c13-11-6-4-8-3-5-10-9(12(8)15-11)2-1-7-14-10;2*1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-7H,(H2,13,15);2*1-8H |
| InChIKey | YKZLYTOGWPJQQJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|