C13H11N3 — CID 63231728
3-methyl-1,7-phenanthrolin-2-amine (PubChem CID 63231728) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-methyl-1,7-phenanthrolin-2-amine.
| Compound Name | 3-methyl-1,7-phenanthrolin-2-amine |
|---|---|
| PubChem CID | 63231728 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-methyl-1,7-phenanthrolin-2-amine |
| SMILES | Cc1cc2ccc3ncccc3c2nc1N |
| InChI | InChI=1S/C13H11N3/c1-8-7-9-4-5-11-10(3-2-6-15-11)12(9)16-13(8)14/h2-7H,1H3,(H2,14,16) |
| InChIKey | QZCDJPBYAOHLDB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|