C9H9N3 — CID 89289464
3-methyl-1,8-naphthyridin-2-amine (PubChem CID 89289464) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-methyl-1,8-naphthyridin-2-amine.
| Compound Name | 3-methyl-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 89289464 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 3-methyl-1,8-naphthyridin-2-amine |
| SMILES | Cc1cc2cccnc2nc1N |
| InChI | InChI=1S/C9H9N3/c1-6-5-7-3-2-4-11-9(7)12-8(6)10/h2-5H,1H3,(H2,10,11,12) |
| InChIKey | TWCNIAOHBHOUEM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |