C9H11N5 — CID 45115760
2-N,2-N-dimethylpyrido[2,3-b]pyrazine-2,3-diamine (PubChem CID 45115760) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-N,2-N-dimethylpyrido[2,3-b]pyrazine-2,3-diamine.
| Compound Name | 2-N,2-N-dimethylpyrido[2,3-b]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 45115760 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2-N,2-N-dimethylpyrido[2,3-b]pyrazine-2,3-diamine |
| SMILES | CN(C)c1nc2cccnc2nc1N |
| InChI | InChI=1S/C9H11N5/c1-14(2)9-7(10)13-8-6(12-9)4-3-5-11-8/h3-5H,1-2H3,(H2,10,11,13) |
| InChIKey | OLIOCYQAAJRCLG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |