C17H23N5 — CID 133439337
2-N,3-N-dimethyl-2-N,3-N-bis(2-methylprop-2-enyl)pyrido[2,3-b]pyrazine-2,3-diamine (PubChem CID 133439337) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-N,3-N-dimethyl-2-N,3-N-bis(2-methylprop-2-enyl)pyrido[2,3-b]pyrazine-2,3-diamine.
| Compound Name | 2-N,3-N-dimethyl-2-N,3-N-bis(2-methylprop-2-enyl)pyrido[2,3-b]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 133439337 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 2-N,3-N-dimethyl-2-N,3-N-bis(2-methylprop-2-enyl)pyrido[2,3-b]pyrazine-2,3-diamine |
| SMILES | C=C(C)CN(C)c1nc2cccnc2nc1N(C)CC(=C)C |
| InChI | InChI=1S/C17H23N5/c1-12(2)10-21(5)16-17(22(6)11-13(3)4)20-15-14(19-16)8-7-9-18-15/h7-9H,1,3,10-11H2,2,4-6H3 |
| InChIKey | CTQBNVORHDRWDE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|