C17H19BrN2 — CID 142548955
7-bromo-N-[(2E)-2,4-dimethylpenta-2,4-dienyl]-N-methylquinolin-8-amine (PubChem CID 142548955) has the molecular formula C17H19BrN2 and a molecular weight of 331.26 g/mol. Its IUPAC name is 7-bromo-N-[(2E)-2,4-dimethylpenta-2,4-dienyl]-N-methylquinolin-8-amine.
| Compound Name | 7-bromo-N-[(2E)-2,4-dimethylpenta-2,4-dienyl]-N-methylquinolin-8-amine |
|---|---|
| PubChem CID | 142548955 |
| Molecular Formula | C17H19BrN2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 7-bromo-N-[(2E)-2,4-dimethylpenta-2,4-dienyl]-N-methylquinolin-8-amine |
| SMILES | C=C(C)/C=C(\C)CN(C)c1c(Br)ccc2cccnc12 |
| InChI | InChI=1S/C17H19BrN2/c1-12(2)10-13(3)11-20(4)17-15(18)8-7-14-6-5-9-19-16(14)17/h5-10H,1,11H2,2-4H3/b13-10+ |
| InChIKey | LRSWNGDBFZNPSR-JLHYYAGUSA-N |
| XLogP | 4.96 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|