C10H12N4O — CID 123475000
2-methoxy-N,N-dimethylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 123475000) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-methoxy-N,N-dimethylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 123475000 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-methoxy-N,N-dimethylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | COc1nc(N(C)C)c2ncccc2n1 |
| InChI | InChI=1S/C10H12N4O/c1-14(2)9-8-7(5-4-6-11-8)12-10(13-9)15-3/h4-6H,1-3H3 |
| InChIKey | FOPXYVIFDLGQCZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |