About 2-(bromomethyl)-1,7-phenanthroline
2-(bromomethyl)-1,7-phenanthroline (PubChem CID 67733291) has the molecular formula C13H9BrN2
and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-(bromomethyl)-1,7-phenanthroline.
Molecular Properties
| Compound Name | 2-(bromomethyl)-1,7-phenanthroline |
| PubChem CID | 67733291 |
| Molecular Formula | C13H9BrN2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 2-(bromomethyl)-1,7-phenanthroline |
| SMILES | BrCc1ccc2ccc3ncccc3c2n1 |
| InChI | InChI=1S/C13H9BrN2/c14-8-10-5-3-9-4-6-12-11(13(9)16-10)2-1-7-15-12/h1-7H,8H2 |
| InChIKey | SYAGFBYYQYBSKL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-1,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-1,7-phenanthroline?
The IUPAC name of 2-(bromomethyl)-1,7-phenanthroline (CID 67733291) is 2-(bromomethyl)-1,7-phenanthroline.
What is the SMILES notation for 2-(bromomethyl)-1,7-phenanthroline?
The canonical SMILES for 2-(bromomethyl)-1,7-phenanthroline is BrCc1ccc2ccc3ncccc3c2n1.
What is the InChIKey of 2-(bromomethyl)-1,7-phenanthroline?
The InChIKey is SYAGFBYYQYBSKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2/c14-8-10-5-3-9-4-6-12-11(13(9)16-10)2-1-7-15-12/h1-7H,8H2.
What are the key properties of 2-(bromomethyl)-1,7-phenanthroline?
2-(bromomethyl)-1,7-phenanthroline has a molecular weight of 273.13 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-1,7-phenanthroline is sourced from PubChem (CID 67733291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).