About iron;2H-1,7-phenanthrolin-2-ide
iron;2H-1,7-phenanthrolin-2-ide (PubChem CID 175242375) has the molecular formula C12H7FeN2-
and a molecular weight of 235.05 g/mol. Its IUPAC name is iron;2H-1,7-phenanthrolin-2-ide.
Molecular Properties
| Compound Name | iron;2H-1,7-phenanthrolin-2-ide |
| PubChem CID | 175242375 |
| Molecular Formula | C12H7FeN2- |
| Molecular Weight | 235.05 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | iron;2H-1,7-phenanthrolin-2-ide |
| SMILES | [Fe].[c-]1ccc2ccc3ncccc3c2n1 |
| InChI | InChI=1S/C12H7N2.Fe/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;/h1-7H;/q-1; |
| InChIKey | PPUBPVFDHXIUJC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.05 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze iron;2H-1,7-phenanthrolin-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;2H-1,7-phenanthrolin-2-ide?
The IUPAC name of iron;2H-1,7-phenanthrolin-2-ide (CID 175242375) is iron;2H-1,7-phenanthrolin-2-ide.
What is the SMILES notation for iron;2H-1,7-phenanthrolin-2-ide?
The canonical SMILES for iron;2H-1,7-phenanthrolin-2-ide is [Fe].[c-]1ccc2ccc3ncccc3c2n1.
What is the InChIKey of iron;2H-1,7-phenanthrolin-2-ide?
The InChIKey is PPUBPVFDHXIUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N2.Fe/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;/h1-7H;/q-1;.
What are the key properties of iron;2H-1,7-phenanthrolin-2-ide?
iron;2H-1,7-phenanthrolin-2-ide has a molecular weight of 235.05 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iron;2H-1,7-phenanthrolin-2-ide is sourced from PubChem (CID 175242375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).