About 3-oxidopyrido[2,3-h]quinazolin-3-ium
3-oxidopyrido[2,3-h]quinazolin-3-ium (PubChem CID 10878094) has the molecular formula C11H7N3O
and a molecular weight of 197.20 g/mol. Its IUPAC name is 3-oxidopyrido[2,3-h]quinazolin-3-ium.
Molecular Properties
| Compound Name | 3-oxidopyrido[2,3-h]quinazolin-3-ium |
| PubChem CID | 10878094 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3-oxidopyrido[2,3-h]quinazolin-3-ium |
| SMILES | [O-][n+]1cnc2c(ccc3ncccc32)c1 |
| InChI | InChI=1S/C11H7N3O/c15-14-6-8-3-4-10-9(2-1-5-12-10)11(8)13-7-14/h1-7H |
| InChIKey | JLBIRRYKFVATMQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxidopyrido[2,3-h]quinazolin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxidopyrido[2,3-h]quinazolin-3-ium?
The IUPAC name of 3-oxidopyrido[2,3-h]quinazolin-3-ium (CID 10878094) is 3-oxidopyrido[2,3-h]quinazolin-3-ium.
What is the SMILES notation for 3-oxidopyrido[2,3-h]quinazolin-3-ium?
The canonical SMILES for 3-oxidopyrido[2,3-h]quinazolin-3-ium is [O-][n+]1cnc2c(ccc3ncccc32)c1.
What is the InChIKey of 3-oxidopyrido[2,3-h]quinazolin-3-ium?
The InChIKey is JLBIRRYKFVATMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O/c15-14-6-8-3-4-10-9(2-1-5-12-10)11(8)13-7-14/h1-7H.
What are the key properties of 3-oxidopyrido[2,3-h]quinazolin-3-ium?
3-oxidopyrido[2,3-h]quinazolin-3-ium has a molecular weight of 197.20 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxidopyrido[2,3-h]quinazolin-3-ium is sourced from PubChem (CID 10878094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).