About 2-chloropyrido[3,2-f]quinoxaline
2-chloropyrido[3,2-f]quinoxaline (PubChem CID 129033345) has the molecular formula C11H6ClN3
and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-chloropyrido[3,2-f]quinoxaline.
Molecular Properties
| Compound Name | 2-chloropyrido[3,2-f]quinoxaline |
| PubChem CID | 129033345 |
| Molecular Formula | C11H6ClN3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-chloropyrido[3,2-f]quinoxaline |
| SMILES | Clc1cnc2ccc3ncccc3c2n1 |
| InChI | InChI=1S/C11H6ClN3/c12-10-6-14-9-4-3-8-7(11(9)15-10)2-1-5-13-8/h1-6H |
| InChIKey | ZEUOZOHRJNSXDG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropyrido[3,2-f]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyrido[3,2-f]quinoxaline?
The IUPAC name of 2-chloropyrido[3,2-f]quinoxaline (CID 129033345) is 2-chloropyrido[3,2-f]quinoxaline.
What is the SMILES notation for 2-chloropyrido[3,2-f]quinoxaline?
The canonical SMILES for 2-chloropyrido[3,2-f]quinoxaline is Clc1cnc2ccc3ncccc3c2n1.
What is the InChIKey of 2-chloropyrido[3,2-f]quinoxaline?
The InChIKey is ZEUOZOHRJNSXDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClN3/c12-10-6-14-9-4-3-8-7(11(9)15-10)2-1-5-13-8/h1-6H.
What are the key properties of 2-chloropyrido[3,2-f]quinoxaline?
2-chloropyrido[3,2-f]quinoxaline has a molecular weight of 215.64 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyrido[3,2-f]quinoxaline is sourced from PubChem (CID 129033345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).