C16H10N4 — CID 10988953
3-phenylpyrido[2,3-h][1,2,4]benzotriazine (PubChem CID 10988953) has the molecular formula C16H10N4 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-phenylpyrido[2,3-h][1,2,4]benzotriazine.
| Compound Name | 3-phenylpyrido[2,3-h][1,2,4]benzotriazine |
|---|---|
| PubChem CID | 10988953 |
| Molecular Formula | C16H10N4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-phenylpyrido[2,3-h][1,2,4]benzotriazine |
| SMILES | c1ccc(-c2nnc3c(ccc4ncccc43)n2)cc1 |
| InChI | InChI=1S/C16H10N4/c1-2-5-11(6-3-1)16-18-14-9-8-13-12(7-4-10-17-13)15(14)19-20-16/h1-10H |
| InChIKey | WBVINXSSVQNRNT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|