C63H37N13 — CID 148686627
5-[3-[4,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3,5-triazin-2-yl]-5-pyrido[2,3-g]quinolin-5-ylphenyl]pyrido[2,3-g]quinoline (PubChem CID 148686627) has the molecular formula C63H37N13 and a molecular weight of 976.08 g/mol. Its IUPAC name is 5-[3-[4,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3,5-triazin-2-yl]-5-pyrido[2,3-g]quinolin-5-ylphenyl]pyrido[2,3-g]quinoline.
| Compound Name | 5-[3-[4,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3,5-triazin-2-yl]-5-pyrido[2,3-g]quinolin-5-ylphenyl]pyrido[2,3-g]quinoline |
|---|---|
| PubChem CID | 148686627 |
| Molecular Formula | C63H37N13 |
| Molecular Weight | 976.08 g/mol |
| Exact Mass | 975.33 |
| IUPAC Name | 5-[3-[4,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3,5-triazin-2-yl]-5-pyrido[2,3-g]quinolin-5-ylphenyl]pyrido[2,3-g]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3nc(-c4cc(-c5c6cccnc6cc6cccnc56)cc(-c5c6cccnc6cc6cccnc56)c4)nc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)n3)n2)cc1 |
| InChI | InChI=1S/C63H37N13/c1-5-17-38(18-6-1)55-68-56(39-19-7-2-8-20-39)71-60(70-55)62-74-59(75-63(76-62)61-72-57(40-21-9-3-10-22-40)69-58(73-61)41-23-11-4-12-24-41)46-34-44(51-47-27-15-29-64-49(47)36-42-25-13-31-66-53(42)51)33-45(35-46)52-48-28-16-30-65-50(48)37-43-26-14-32-67-54(43)52/h1-37H |
| InChIKey | NSQGGDWEOHLAJF-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 167.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.08 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|