C75H45N13 — CID 153466323
5-[3-[4,6-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,10-phenanthroline (PubChem CID 153466323) has the molecular formula C75H45N13 and a molecular weight of 1128.28 g/mol. Its IUPAC name is 5-[3-[4,6-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 5-[3-[4,6-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 153466323 |
| Molecular Formula | C75H45N13 |
| Molecular Weight | 1128.28 g/mol |
| Exact Mass | 1127.39 |
| IUPAC Name | 5-[3-[4,6-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4nc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)nc(-c5cc(-c6cc7cccnc7c7ncccc67)cc(-c6cc7cccnc7c7ncccc67)c5)n4)cc3)n2)cc1 |
| InChI | InChI=1S/C75H45N13/c1-5-17-46(18-6-1)67-80-68(47-19-7-2-8-20-47)83-71(82-67)50-29-33-52(34-30-50)73-86-74(53-35-31-51(32-36-53)72-84-69(48-21-9-3-10-22-48)81-70(85-72)49-23-11-4-12-24-49)88-75(87-73)58-42-56(61-44-54-25-13-37-76-63(54)65-59(61)27-15-39-78-65)41-57(43-58)62-45-55-26-14-38-77-64(55)66-60(62)28-16-40-79-66/h1-45H |
| InChIKey | YQWOCAKRNLUDCD-UHFFFAOYSA-N |
| XLogP | 16.77 |
| TPSA | 167.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1128.28 |
| LogP ≤ 5 | 16.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|