C42H26N6 — CID 158941030
5-[3-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-5-pyridin-2-ylphenyl]-1,10-phenanthroline (PubChem CID 158941030) has the molecular formula C42H26N6 and a molecular weight of 614.71 g/mol. Its IUPAC name is 5-[3-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-5-pyridin-2-ylphenyl]-1,10-phenanthroline.
| Compound Name | 5-[3-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-5-pyridin-2-ylphenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 158941030 |
| Molecular Formula | C42H26N6 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 5-[3-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-5-pyridin-2-ylphenyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2nc(-c3cc(-c4ccccn4)cc(-c4cc5cccnc5c5ncccc45)c3)nc(-c3ccc4ccccc4c3)n2)cc1 |
| InChI | InChI=1S/C42H26N6/c1-2-11-28(12-3-1)40-46-41(31-18-17-27-10-4-5-13-29(27)22-31)48-42(47-40)34-24-32(23-33(25-34)37-16-6-7-19-43-37)36-26-30-14-8-20-44-38(30)39-35(36)15-9-21-45-39/h1-26H |
| InChIKey | PYYKRMRAURPEJZ-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|