C55H33N9 — CID 153466098
5-[3-[4,6-bis(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,10-phenanthroline (PubChem CID 153466098) has the molecular formula C55H33N9 and a molecular weight of 819.93 g/mol. Its IUPAC name is 5-[3-[4,6-bis(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 5-[3-[4,6-bis(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 153466098 |
| Molecular Formula | C55H33N9 |
| Molecular Weight | 819.93 g/mol |
| Exact Mass | 819.29 |
| IUPAC Name | 5-[3-[4,6-bis(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]-5-(1,10-phenanthrolin-5-yl)phenyl]-1,10-phenanthroline |
| SMILES | c1cncc(-c2ccc(-c3nc(-c4ccc(-c5cccnc5)cc4)nc(-c4cc(-c5cc6cccnc6c6ncccc56)cc(-c5cc6cccnc6c6ncccc56)c4)n3)cc2)c1 |
| InChI | InChI=1S/C55H33N9/c1-9-40(32-56-21-1)34-13-17-36(18-14-34)53-62-54(37-19-15-35(16-20-37)41-10-2-22-57-33-41)64-55(63-53)44-28-42(47-30-38-7-3-23-58-49(38)51-45(47)11-5-25-60-51)27-43(29-44)48-31-39-8-4-24-59-50(39)52-46(48)12-6-26-61-52/h1-33H |
| InChIKey | XVPMWVUZKRJFMG-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.93 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|