C39H23N7 — CID 146474033
2-[6-(1,10-phenanthrolin-2-yl)-2-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]-1,10-phenanthroline (PubChem CID 146474033) has the molecular formula C39H23N7 and a molecular weight of 589.66 g/mol. Its IUPAC name is 2-[6-(1,10-phenanthrolin-2-yl)-2-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]-1,10-phenanthroline.
| Compound Name | 2-[6-(1,10-phenanthrolin-2-yl)-2-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 146474033 |
| Molecular Formula | C39H23N7 |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | 2-[6-(1,10-phenanthrolin-2-yl)-2-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]-1,10-phenanthroline |
| SMILES | c1cncc(-c2ccc(-c3nc(-c4ccc5ccc6cccnc6c5n4)cc(-c4ccc5ccc6cccnc6c5n4)n3)cc2)c1 |
| InChI | InChI=1S/C39H23N7/c1-6-30(23-40-19-1)24-7-13-29(14-8-24)39-45-33(31-17-15-27-11-9-25-4-2-20-41-35(25)37(27)43-31)22-34(46-39)32-18-16-28-12-10-26-5-3-21-42-36(26)38(28)44-32/h1-23H |
| InChIKey | YBCQMKXVZACLFE-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|