C52H30N8 — CID 137489964
4-[4-[4,6-bis[4-(1,10-phenanthrolin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 137489964) has the molecular formula C52H30N8 and a molecular weight of 766.87 g/mol. Its IUPAC name is 4-[4-[4,6-bis[4-(1,10-phenanthrolin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[4,6-bis[4-(1,10-phenanthrolin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 137489964 |
| Molecular Formula | C52H30N8 |
| Molecular Weight | 766.87 g/mol |
| Exact Mass | 766.26 |
| IUPAC Name | 4-[4-[4,6-bis[4-(1,10-phenanthrolin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccc6ccc7cccnc7c6n5)cc4)nc(-c4ccc(-c5ccc6ccc7cccnc7c6n5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C52H30N8/c53-31-32-5-7-33(8-6-32)34-9-19-41(20-10-34)50-58-51(42-21-11-35(12-22-42)44-27-25-39-17-15-37-3-1-29-54-46(37)48(39)56-44)60-52(59-50)43-23-13-36(14-24-43)45-28-26-40-18-16-38-4-2-30-55-47(38)49(40)57-45/h1-30H |
| InChIKey | NALJCWYYQBMENJ-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.87 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|