C40H28N6 — CID 159356699
5-[3-(2,6-dimethyl-3-pyridinyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline (PubChem CID 159356699) has the molecular formula C40H28N6 and a molecular weight of 592.71 g/mol. Its IUPAC name is 5-[3-(2,6-dimethyl-3-pyridinyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 5-[3-(2,6-dimethyl-3-pyridinyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 159356699 |
| Molecular Formula | C40H28N6 |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 5-[3-(2,6-dimethyl-3-pyridinyl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline |
| SMILES | Cc1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3cc4cccnc4c4ncccc34)c2)c(C)n1 |
| InChI | InChI=1S/C40H28N6/c1-25-17-18-33(26(2)43-25)30-21-31(35-24-29-15-9-19-41-36(29)37-34(35)16-10-20-42-37)23-32(22-30)40-45-38(27-11-5-3-6-12-27)44-39(46-40)28-13-7-4-8-14-28/h3-24H,1-2H3 |
| InChIKey | FFXCCIZAKDYLLY-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|