C43H31N3 — CID 176622520
2-[3-(2,6-dimethyl-3-pyridinyl)-5-phenanthren-9-ylphenyl]-4,6-diphenylpyrimidine (PubChem CID 176622520) has the molecular formula C43H31N3 and a molecular weight of 589.74 g/mol. Its IUPAC name is 2-[3-(2,6-dimethyl-3-pyridinyl)-5-phenanthren-9-ylphenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[3-(2,6-dimethyl-3-pyridinyl)-5-phenanthren-9-ylphenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 176622520 |
| Molecular Formula | C43H31N3 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | 2-[3-(2,6-dimethyl-3-pyridinyl)-5-phenanthren-9-ylphenyl]-4,6-diphenylpyrimidine |
| SMILES | Cc1ccc(-c2cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc(-c3cc4ccccc4c4ccccc34)c2)c(C)n1 |
| InChI | InChI=1S/C43H31N3/c1-28-21-22-36(29(2)44-28)33-23-34(40-26-32-17-9-10-18-37(32)38-19-11-12-20-39(38)40)25-35(24-33)43-45-41(30-13-5-3-6-14-30)27-42(46-43)31-15-7-4-8-16-31/h3-27H,1-2H3 |
| InChIKey | DMEGEZYGSMKXSW-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|