C49H36N3+ — CID 176622503
2-[3-(1,5-dimethylpyridin-1-ium-3-yl)-5-phenanthren-9-ylphenyl]-4-phenyl-6-(3-phenylphenyl)pyrimidine (PubChem CID 176622503) has the molecular formula C49H36N3+ and a molecular weight of 666.85 g/mol. Its IUPAC name is 2-[3-(1,5-dimethylpyridin-1-ium-3-yl)-5-phenanthren-9-ylphenyl]-4-phenyl-6-(3-phenylphenyl)pyrimidine.
| Compound Name | 2-[3-(1,5-dimethylpyridin-1-ium-3-yl)-5-phenanthren-9-ylphenyl]-4-phenyl-6-(3-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 176622503 |
| Molecular Formula | C49H36N3+ |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 2-[3-(1,5-dimethylpyridin-1-ium-3-yl)-5-phenanthren-9-ylphenyl]-4-phenyl-6-(3-phenylphenyl)pyrimidine |
| SMILES | Cc1cc(-c2cc(-c3nc(-c4ccccc4)cc(-c4cccc(-c5ccccc5)c4)n3)cc(-c3cc4ccccc4c4ccccc34)c2)c[n+](C)c1 |
| InChI | InChI=1S/C49H36N3/c1-33-24-42(32-52(2)31-33)39-26-40(46-29-37-18-9-10-21-43(37)44-22-11-12-23-45(44)46)28-41(27-39)49-50-47(35-16-7-4-8-17-35)30-48(51-49)38-20-13-19-36(25-38)34-14-5-3-6-15-34/h3-32H,1-2H3/q+1 |
| InChIKey | XCWQRDZTCAFPIS-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|