C49H35N3 — CID 176622469
2-[3-(2,6-dimethyl-4-pyridinyl)-5-phenanthren-9-ylphenyl]-4-phenyl-6-(4-phenylphenyl)pyrimidine (PubChem CID 176622469) has the molecular formula C49H35N3 and a molecular weight of 665.84 g/mol. Its IUPAC name is 2-[3-(2,6-dimethyl-4-pyridinyl)-5-phenanthren-9-ylphenyl]-4-phenyl-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 2-[3-(2,6-dimethyl-4-pyridinyl)-5-phenanthren-9-ylphenyl]-4-phenyl-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 176622469 |
| Molecular Formula | C49H35N3 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | 2-[3-(2,6-dimethyl-4-pyridinyl)-5-phenanthren-9-ylphenyl]-4-phenyl-6-(4-phenylphenyl)pyrimidine |
| SMILES | Cc1cc(-c2cc(-c3nc(-c4ccccc4)cc(-c4ccc(-c5ccccc5)cc4)n3)cc(-c3cc4ccccc4c4ccccc34)c2)cc(C)n1 |
| InChI | InChI=1S/C49H35N3/c1-32-25-39(26-33(2)50-32)40-27-41(46-30-38-17-9-10-18-43(38)44-19-11-12-20-45(44)46)29-42(28-40)49-51-47(36-15-7-4-8-16-36)31-48(52-49)37-23-21-35(22-24-37)34-13-5-3-6-14-34/h3-31H,1-2H3 |
| InChIKey | MJJJTBACNQNWLY-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|