C23H17N3O2S — CID 11133109
N-benzo[b][1,7]phenanthrolin-10-yl-4-methylbenzenesulfonamide (PubChem CID 11133109) has the molecular formula C23H17N3O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is N-benzo[b][1,7]phenanthrolin-10-yl-4-methylbenzenesulfonamide.
| Compound Name | N-benzo[b][1,7]phenanthrolin-10-yl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11133109 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-benzo[b][1,7]phenanthrolin-10-yl-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3cc4ccc5ncccc5c4nc3c2)cc1 |
| InChI | InChI=1S/C23H17N3O2S/c1-15-4-9-19(10-5-15)29(27,28)26-18-8-6-16-13-17-7-11-21-20(3-2-12-24-21)23(17)25-22(16)14-18/h2-14,26H,1H3 |
| InChIKey | BTKAKKQNLKEAQQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|