C19H16N4O2S — CID 102264141
N-(6-amino-1,10-phenanthrolin-5-yl)-4-methylbenzenesulfonamide (PubChem CID 102264141) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-(6-amino-1,10-phenanthrolin-5-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(6-amino-1,10-phenanthrolin-5-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102264141 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(6-amino-1,10-phenanthrolin-5-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(N)c3cccnc3c3ncccc23)cc1 |
| InChI | InChI=1S/C19H16N4O2S/c1-12-6-8-13(9-7-12)26(24,25)23-17-15-5-3-11-22-19(15)18-14(16(17)20)4-2-10-21-18/h2-11,23H,20H2,1H3 |
| InChIKey | XGFTTZJKIGEKJO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|