C9H12N4 — CID 145271265
1,2,4-benzotriazin-6-amine;ethane (PubChem CID 145271265) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,2,4-benzotriazin-6-amine;ethane.
| Compound Name | 1,2,4-benzotriazin-6-amine;ethane |
|---|---|
| PubChem CID | 145271265 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1,2,4-benzotriazin-6-amine;ethane |
| SMILES | CC.Nc1ccc2nncnc2c1 |
| InChI | InChI=1S/C7H6N4.C2H6/c8-5-1-2-6-7(3-5)9-4-10-11-6;1-2/h1-4H,8H2;1-2H3 |
| InChIKey | UAKMTAKXZJMRRY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|