About methanethiol;quinazolin-7-amine
methanethiol;quinazolin-7-amine (PubChem CID 156844903) has the molecular formula C9H11N3S
and a molecular weight of 193.28 g/mol. Its IUPAC name is methanethiol;quinazolin-7-amine.
Molecular Properties
| Compound Name | methanethiol;quinazolin-7-amine |
| PubChem CID | 156844903 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | methanethiol;quinazolin-7-amine |
| SMILES | CS.Nc1ccc2cncnc2c1 |
| InChI | InChI=1S/C8H7N3.CH4S/c9-7-2-1-6-4-10-5-11-8(6)3-7;1-2/h1-5H,9H2;2H,1H3 |
| InChIKey | FOBOESARRMGBMK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;quinazolin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;quinazolin-7-amine?
The IUPAC name of methanethiol;quinazolin-7-amine (CID 156844903) is methanethiol;quinazolin-7-amine.
What is the SMILES notation for methanethiol;quinazolin-7-amine?
The canonical SMILES for methanethiol;quinazolin-7-amine is CS.Nc1ccc2cncnc2c1.
What is the InChIKey of methanethiol;quinazolin-7-amine?
The InChIKey is FOBOESARRMGBMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.CH4S/c9-7-2-1-6-4-10-5-11-8(6)3-7;1-2/h1-5H,9H2;2H,1H3.
What are the key properties of methanethiol;quinazolin-7-amine?
methanethiol;quinazolin-7-amine has a molecular weight of 193.28 g/mol, XLogP of 1.76, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;quinazolin-7-amine is sourced from PubChem (CID 156844903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).