C9H10N4 — CID 163482981
2-N-methylquinazoline-2,7-diamine (PubChem CID 163482981) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 2-N-methylquinazoline-2,7-diamine.
| Compound Name | 2-N-methylquinazoline-2,7-diamine |
|---|---|
| PubChem CID | 163482981 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-N-methylquinazoline-2,7-diamine |
| SMILES | CNc1ncc2ccc(N)cc2n1 |
| InChI | InChI=1S/C9H10N4/c1-11-9-12-5-6-2-3-7(10)4-8(6)13-9/h2-5H,10H2,1H3,(H,11,12,13) |
| InChIKey | CGDXWBXTJQPOGY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|