C20H17N3O — CID 144587163
1-[4-methyl-3-[2-[2-(methylamino)quinazolin-7-yl]ethynyl]phenyl]ethanone (PubChem CID 144587163) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[4-methyl-3-[2-[2-(methylamino)quinazolin-7-yl]ethynyl]phenyl]ethanone.
| Compound Name | 1-[4-methyl-3-[2-[2-(methylamino)quinazolin-7-yl]ethynyl]phenyl]ethanone |
|---|---|
| PubChem CID | 144587163 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-[4-methyl-3-[2-[2-(methylamino)quinazolin-7-yl]ethynyl]phenyl]ethanone |
| SMILES | CNc1ncc2ccc(C#Cc3cc(C(C)=O)ccc3C)cc2n1 |
| InChI | InChI=1S/C20H17N3O/c1-13-4-7-17(14(2)24)11-16(13)8-5-15-6-9-18-12-22-20(21-3)23-19(18)10-15/h4,6-7,9-12H,1-3H3,(H,21,22,23) |
| InChIKey | MPKBRPPXMUYDPM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|