C18H23N3 — CID 142584876
N-methyl-7-[(2E,5E)-5-methylocta-2,5-dien-3-yl]quinazolin-2-amine (PubChem CID 142584876) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-methyl-7-[(2E,5E)-5-methylocta-2,5-dien-3-yl]quinazolin-2-amine.
| Compound Name | N-methyl-7-[(2E,5E)-5-methylocta-2,5-dien-3-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 142584876 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-methyl-7-[(2E,5E)-5-methylocta-2,5-dien-3-yl]quinazolin-2-amine |
| SMILES | C/C=C(\C/C(C)=C/CC)c1ccc2cnc(NC)nc2c1 |
| InChI | InChI=1S/C18H23N3/c1-5-7-13(3)10-14(6-2)15-8-9-16-12-20-18(19-4)21-17(16)11-15/h6-9,11-12H,5,10H2,1-4H3,(H,19,20,21)/b13-7+,14-6+ |
| InChIKey | QTYIRHZCVMARST-CAZMDNNUSA-N |
| XLogP | 4.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|