C25H29FN4O3 — CID 142583731
7-[(Z)-1-[[(E)-but-1-enyl]-methylamino]prop-1-enyl]-N-methylquinazolin-2-amine;2-(4-fluorophenyl)-2,2-dihydroxyacetaldehyde (PubChem CID 142583731) has the molecular formula C25H29FN4O3 and a molecular weight of 452.53 g/mol. Its IUPAC name is 7-[(Z)-1-[[(E)-but-1-enyl]-methylamino]prop-1-enyl]-N-methylquinazolin-2-amine;2-(4-fluorophenyl)-2,2-dihydroxyacetaldehyde.
| Compound Name | 7-[(Z)-1-[[(E)-but-1-enyl]-methylamino]prop-1-enyl]-N-methylquinazolin-2-amine;2-(4-fluorophenyl)-2,2-dihydroxyacetaldehyde |
|---|---|
| PubChem CID | 142583731 |
| Molecular Formula | C25H29FN4O3 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 7-[(Z)-1-[[(E)-but-1-enyl]-methylamino]prop-1-enyl]-N-methylquinazolin-2-amine;2-(4-fluorophenyl)-2,2-dihydroxyacetaldehyde |
| SMILES | C/C=C(/c1ccc2cnc(NC)nc2c1)N(C)/C=C/CC.O=CC(O)(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H22N4.C8H7FO3/c1-5-7-10-21(4)16(6-2)13-8-9-14-12-19-17(18-3)20-15(14)11-13;9-7-3-1-6(2-4-7)8(11,12)5-10/h6-12H,5H2,1-4H3,(H,18,19,20);1-5,11-12H/b10-7+,16-6-; |
| InChIKey | PXWMGAIALYTZAU-ANGMAQIDSA-N |
| XLogP | 4.05 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|