C29H30F3N5O2 — CID 58830060
N-[2-[3-(dimethylamino)propoxy]-5-(trifluoromethyl)phenyl]-4-methyl-3-[2-(methylamino)quinazolin-6-yl]benzamide (PubChem CID 58830060) has the molecular formula C29H30F3N5O2 and a molecular weight of 537.59 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)propoxy]-5-(trifluoromethyl)phenyl]-4-methyl-3-[2-(methylamino)quinazolin-6-yl]benzamide.
| Compound Name | N-[2-[3-(dimethylamino)propoxy]-5-(trifluoromethyl)phenyl]-4-methyl-3-[2-(methylamino)quinazolin-6-yl]benzamide |
|---|---|
| PubChem CID | 58830060 |
| Molecular Formula | C29H30F3N5O2 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | N-[2-[3-(dimethylamino)propoxy]-5-(trifluoromethyl)phenyl]-4-methyl-3-[2-(methylamino)quinazolin-6-yl]benzamide |
| SMILES | CNc1ncc2cc(-c3cc(C(=O)Nc4cc(C(F)(F)F)ccc4OCCCN(C)C)ccc3C)ccc2n1 |
| InChI | InChI=1S/C29H30F3N5O2/c1-18-6-7-20(15-23(18)19-8-10-24-21(14-19)17-34-28(33-2)36-24)27(38)35-25-16-22(29(30,31)32)9-11-26(25)39-13-5-12-37(3)4/h6-11,14-17H,5,12-13H2,1-4H3,(H,35,38)(H,33,34,36) |
| InChIKey | NLRVJUIUELYKFV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|