C28H28F3N5O2 — CID 58829444
3-(2-aminoquinazolin-6-yl)-N-[3-[3-(dimethylamino)propoxy]-5-(trifluoromethyl)phenyl]-4-methylbenzamide (PubChem CID 58829444) has the molecular formula C28H28F3N5O2 and a molecular weight of 523.56 g/mol. Its IUPAC name is 3-(2-aminoquinazolin-6-yl)-N-[3-[3-(dimethylamino)propoxy]-5-(trifluoromethyl)phenyl]-4-methylbenzamide.
| Compound Name | 3-(2-aminoquinazolin-6-yl)-N-[3-[3-(dimethylamino)propoxy]-5-(trifluoromethyl)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58829444 |
| Molecular Formula | C28H28F3N5O2 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 3-(2-aminoquinazolin-6-yl)-N-[3-[3-(dimethylamino)propoxy]-5-(trifluoromethyl)phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(OCCCN(C)C)cc(C(F)(F)F)c2)cc1-c1ccc2nc(N)ncc2c1 |
| InChI | InChI=1S/C28H28F3N5O2/c1-17-5-6-19(12-24(17)18-7-8-25-20(11-18)16-33-27(32)35-25)26(37)34-22-13-21(28(29,30)31)14-23(15-22)38-10-4-9-36(2)3/h5-8,11-16H,4,9-10H2,1-3H3,(H,34,37)(H2,32,33,35) |
| InChIKey | SUWTTWKUUCFSKU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|