C26H23F3N4O — CID 58829992
3-(2-aminoquinazolin-6-yl)-4-methyl-N-[4-propan-2-yl-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 58829992) has the molecular formula C26H23F3N4O and a molecular weight of 464.49 g/mol. Its IUPAC name is 3-(2-aminoquinazolin-6-yl)-4-methyl-N-[4-propan-2-yl-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(2-aminoquinazolin-6-yl)-4-methyl-N-[4-propan-2-yl-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58829992 |
| Molecular Formula | C26H23F3N4O |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-(2-aminoquinazolin-6-yl)-4-methyl-N-[4-propan-2-yl-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(C)C)cc2C(F)(F)F)cc1-c1ccc2nc(N)ncc2c1 |
| InChI | InChI=1S/C26H23F3N4O/c1-14(2)16-6-9-23(21(12-16)26(27,28)29)32-24(34)18-5-4-15(3)20(11-18)17-7-8-22-19(10-17)13-31-25(30)33-22/h4-14H,1-3H3,(H,32,34)(H2,30,31,33) |
| InChIKey | CZHMMGNKYDYJAY-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |