C23H20N5O3- — CID 58829691
3-(2-aminoquinazolin-6-yl)-N-[5-[hydroxy(oxido)amino]-2-methylphenyl]-4-methylbenzamide (PubChem CID 58829691) has the molecular formula C23H20N5O3- and a molecular weight of 414.45 g/mol. Its IUPAC name is 3-(2-aminoquinazolin-6-yl)-N-[5-[hydroxy(oxido)amino]-2-methylphenyl]-4-methylbenzamide.
| Compound Name | 3-(2-aminoquinazolin-6-yl)-N-[5-[hydroxy(oxido)amino]-2-methylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58829691 |
| Molecular Formula | C23H20N5O3- |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-(2-aminoquinazolin-6-yl)-N-[5-[hydroxy(oxido)amino]-2-methylphenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(N([O-])O)cc1NC(=O)c1ccc(C)c(-c2ccc3nc(N)ncc3c2)c1 |
| InChI | InChI=1S/C23H20N5O3/c1-13-3-5-16(22(29)26-21-11-18(28(30)31)7-4-14(21)2)10-19(13)15-6-8-20-17(9-15)12-25-23(24)27-20/h3-12,30H,1-2H3,(H,26,29)(H2,24,25,27)/q-1 |
| InChIKey | CLMNUIGGWKFXAD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|