C29H31F3N6O — CID 69465278
3-(2-aminoquinazolin-6-yl)-N-[2-[4-(dimethylamino)butylamino]-4-(trifluoromethyl)phenyl]-4-methylbenzamide (PubChem CID 69465278) has the molecular formula C29H31F3N6O and a molecular weight of 536.60 g/mol. Its IUPAC name is 3-(2-aminoquinazolin-6-yl)-N-[2-[4-(dimethylamino)butylamino]-4-(trifluoromethyl)phenyl]-4-methylbenzamide.
| Compound Name | 3-(2-aminoquinazolin-6-yl)-N-[2-[4-(dimethylamino)butylamino]-4-(trifluoromethyl)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 69465278 |
| Molecular Formula | C29H31F3N6O |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 3-(2-aminoquinazolin-6-yl)-N-[2-[4-(dimethylamino)butylamino]-4-(trifluoromethyl)phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(F)(F)F)cc2NCCCCN(C)C)cc1-c1ccc2nc(N)ncc2c1 |
| InChI | InChI=1S/C29H31F3N6O/c1-18-6-7-20(15-23(18)19-8-10-24-21(14-19)17-35-28(33)37-24)27(39)36-25-11-9-22(29(30,31)32)16-26(25)34-12-4-5-13-38(2)3/h6-11,14-17,34H,4-5,12-13H2,1-3H3,(H,36,39)(H2,33,35,37) |
| InChIKey | VBVZYMFPZAWLRZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|