C23H19FN4O — CID 58829952
3-(2-aminoquinazolin-6-yl)-N-(2-fluoro-5-methylphenyl)-4-methylbenzamide (PubChem CID 58829952) has the molecular formula C23H19FN4O and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-(2-aminoquinazolin-6-yl)-N-(2-fluoro-5-methylphenyl)-4-methylbenzamide.
| Compound Name | 3-(2-aminoquinazolin-6-yl)-N-(2-fluoro-5-methylphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 58829952 |
| Molecular Formula | C23H19FN4O |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-(2-aminoquinazolin-6-yl)-N-(2-fluoro-5-methylphenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2ccc(C)c(-c3ccc4nc(N)ncc4c3)c2)c1 |
| InChI | InChI=1S/C23H19FN4O/c1-13-3-7-19(24)21(9-13)27-22(29)16-5-4-14(2)18(11-16)15-6-8-20-17(10-15)12-26-23(25)28-20/h3-12H,1-2H3,(H,27,29)(H2,25,26,28) |
| InChIKey | HXCZTDFSMDNDQK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |