C23H19N5O3 — CID 69461436
3-(2-aminoquinazolin-6-yl)-4-methyl-N-(2-methyl-5-nitrophenyl)benzamide (PubChem CID 69461436) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 3-(2-aminoquinazolin-6-yl)-4-methyl-N-(2-methyl-5-nitrophenyl)benzamide.
| Compound Name | 3-(2-aminoquinazolin-6-yl)-4-methyl-N-(2-methyl-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 69461436 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-(2-aminoquinazolin-6-yl)-4-methyl-N-(2-methyl-5-nitrophenyl)benzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1ccc(C)c(-c2ccc3nc(N)ncc3c2)c1 |
| InChI | InChI=1S/C23H19N5O3/c1-13-3-5-16(22(29)26-21-11-18(28(30)31)7-4-14(21)2)10-19(13)15-6-8-20-17(9-15)12-25-23(24)27-20/h3-12H,1-2H3,(H,26,29)(H2,24,25,27) |
| InChIKey | HZXLCPSGDZSISY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|