C30H32F3N5O — CID 58829132
3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 58829132) has the molecular formula C30H32F3N5O and a molecular weight of 535.61 g/mol. Its IUPAC name is 3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58829132 |
| Molecular Formula | C30H32F3N5O |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCN(CC)CCCNc1ncc2cc(-c3cc(C(=O)Nc4cccc(C(F)(F)F)c4)ccc3C)ccc2n1 |
| InChI | InChI=1S/C30H32F3N5O/c1-4-38(5-2)15-7-14-34-29-35-19-23-16-21(12-13-27(23)37-29)26-17-22(11-10-20(26)3)28(39)36-25-9-6-8-24(18-25)30(31,32)33/h6,8-13,16-19H,4-5,7,14-15H2,1-3H3,(H,36,39)(H,34,35,37) |
| InChIKey | VXLFZMTUXGIZHX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|