C32H37FN6O3 — CID 58829135
3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-N-[4-fluoro-3-[(2-methoxyacetyl)amino]phenyl]-4-methylbenzamide (PubChem CID 58829135) has the molecular formula C32H37FN6O3 and a molecular weight of 572.69 g/mol. Its IUPAC name is 3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-N-[4-fluoro-3-[(2-methoxyacetyl)amino]phenyl]-4-methylbenzamide.
| Compound Name | 3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-N-[4-fluoro-3-[(2-methoxyacetyl)amino]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58829135 |
| Molecular Formula | C32H37FN6O3 |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-N-[4-fluoro-3-[(2-methoxyacetyl)amino]phenyl]-4-methylbenzamide |
| SMILES | CCN(CC)CCCNc1ncc2cc(-c3cc(C(=O)Nc4ccc(F)c(NC(=O)COC)c4)ccc3C)ccc2n1 |
| InChI | InChI=1S/C32H37FN6O3/c1-5-39(6-2)15-7-14-34-32-35-19-24-16-22(10-13-28(24)38-32)26-17-23(9-8-21(26)3)31(41)36-25-11-12-27(33)29(18-25)37-30(40)20-42-4/h8-13,16-19H,5-7,14-15,20H2,1-4H3,(H,36,41)(H,37,40)(H,34,35,38) |
| InChIKey | WCLJZYKLRXVNBO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|