C31H31F6N5O — CID 58829144
N-[3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-4-methylphenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 58829144) has the molecular formula C31H31F6N5O and a molecular weight of 603.61 g/mol. Its IUPAC name is N-[3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-4-methylphenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-4-methylphenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58829144 |
| Molecular Formula | C31H31F6N5O |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | N-[3-[2-[3-(diethylamino)propylamino]quinazolin-6-yl]-4-methylphenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CCN(CC)CCCNc1ncc2cc(-c3cc(NC(=O)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc3C)ccc2n1 |
| InChI | InChI=1S/C31H31F6N5O/c1-4-42(5-2)12-6-11-38-29-39-18-22-13-20(8-10-27(22)41-29)26-17-25(9-7-19(26)3)40-28(43)21-14-23(30(32,33)34)16-24(15-21)31(35,36)37/h7-10,13-18H,4-6,11-12H2,1-3H3,(H,40,43)(H,38,39,41) |
| InChIKey | FKPVJKBAHBOCMI-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|