C23H16ClF3N4O — CID 58829569
N-[3-(2-aminoquinazolin-6-yl)-5-chloro-4-methylphenyl]-4-(trifluoromethyl)benzamide (PubChem CID 58829569) has the molecular formula C23H16ClF3N4O and a molecular weight of 456.86 g/mol. Its IUPAC name is N-[3-(2-aminoquinazolin-6-yl)-5-chloro-4-methylphenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(2-aminoquinazolin-6-yl)-5-chloro-4-methylphenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58829569 |
| Molecular Formula | C23H16ClF3N4O |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-[3-(2-aminoquinazolin-6-yl)-5-chloro-4-methylphenyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1c(Cl)cc(NC(=O)c2ccc(C(F)(F)F)cc2)cc1-c1ccc2nc(N)ncc2c1 |
| InChI | InChI=1S/C23H16ClF3N4O/c1-12-18(14-4-7-20-15(8-14)11-29-22(28)31-20)9-17(10-19(12)24)30-21(32)13-2-5-16(6-3-13)23(25,26)27/h2-11H,1H3,(H,30,32)(H2,28,29,31) |
| InChIKey | LDPVAPQKGGROHZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |