C24H19F3N4O2 — CID 58829464
3-(4-aminoquinazolin-6-yl)-N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-methylbenzamide (PubChem CID 58829464) has the molecular formula C24H19F3N4O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is 3-(4-aminoquinazolin-6-yl)-N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-methylbenzamide.
| Compound Name | 3-(4-aminoquinazolin-6-yl)-N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58829464 |
| Molecular Formula | C24H19F3N4O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3-(4-aminoquinazolin-6-yl)-N-[2-methoxy-5-(trifluoromethyl)phenyl]-4-methylbenzamide |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)c1ccc(C)c(-c2ccc3ncnc(N)c3c2)c1 |
| InChI | InChI=1S/C24H19F3N4O2/c1-13-3-4-15(10-17(13)14-5-7-19-18(9-14)22(28)30-12-29-19)23(32)31-20-11-16(24(25,26)27)6-8-21(20)33-2/h3-12H,1-2H3,(H,31,32)(H2,28,29,30) |
| InChIKey | MHWIMQYRYXNWJV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |