C15H10F3N3O2 — CID 112523297
2-cyano-N-[2-methoxy-5-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 112523297) has the molecular formula C15H10F3N3O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-cyano-N-[2-methoxy-5-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-cyano-N-[2-methoxy-5-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 112523297 |
| Molecular Formula | C15H10F3N3O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-cyano-N-[2-methoxy-5-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)c1ccnc(C#N)c1 |
| InChI | InChI=1S/C15H10F3N3O2/c1-23-13-3-2-10(15(16,17)18)7-12(13)21-14(22)9-4-5-20-11(6-9)8-19/h2-7H,1H3,(H,21,22) |
| InChIKey | LDFCZSQFTCCZEA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |